Product Overview
Benzoylaconine | T6S1880 | TargetMol Chemicals
CAS: 466-24-0
Smiles: CCN1C[C@@]2(COC)[C@H]3[C@@H](OC)[C@H]4C1[C@@]3([C@@H]1C[C@@]3(O)[C@H](OC(=O)c5ccccc5)[C@@H]1[C@]4(O)[C@@H](O)[C@@H]3OC)[C@H](C[C@H]2O)OC
Formula: C32H45NO10
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Benzoylaconine is an alkaloid in the Chinese traditional medicine Radix Aconiti Lateralis Preparata (Fuzi). Benzoylaconine and aconitine can induce reproductive toxicity in BeWo Cell, the amino acid metabolism was the main metabolic pathway and responsible for the placental and fetal toxicity of them.
Molecular Weight: 603, 709