Product Overview
Berberrubine chloride | T4S0795 | TargetMol Chemicals
CAS: 15401-69-1
Smiles: [Cl-].COc1ccc2cc3-c4cc5OCOc5cc4CC[n+]3cc2c1O
Formula: C19H16ClNO4
Pathway: Immunology/Inflammation
Target: IL Receptor
Receptor: N/A
Bioactivity: 1. Berberrubine has antitumor activity. 2. Berberrubine has antidiabetic activity. 3. Berberrubine dose-dependently inhibits IL-8 and MCP-1 protein levels in the media and mRNA expression of the cells stimulated with IL-1beta or TNF-alpha.
Molecular Weight: 357, 79
