Product Overview
Betamethasone dipropionate | T1559 | TargetMol Chemicals
CAS: 5593-20-4
Smiles: CCC(=O)OCC(=O)[C@@]1(OC(=O)CC)[C@@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]12C
Formula: C28H37FO7
Pathway: Endocrinology/Hormones
Target: Glucocorticoid Receptor
Receptor: N/A
Bioactivity: Betamethasone Dipropionate is the 17, 21-dipropionate ester of betamethasone, a synthetic glucocorticoid with metabolic, immunosuppressive and anti-inflammatory actions. Betamethasone dipropionate binds to specific intracellular glucocorticoid receptors and subsequently binds to DNA to modify gene expression. The synthesis of certain anti-inflammatory proteins is induced while the synthesis of certain inflammatory mediators is inhibited. As a result, there is an overall reduction in chronic inflammation and autoimmune reactions.
Molecular Weight: 504, 595
