Product Overview
Bis-PEG5-acid | T14642 | TargetMol Chemicals
CAS: 439114-13-3
Smiles: OC(=O)CCOCCOCCOCCOCCOCCC(O)=O
Formula: C14H26O9
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Bis-PEG5-acid (PROTAC Linker 36) is a PROTAC linker, which belongs to a polyethylene glycol (PEG) linker. Bis-PEG5-acid (PROTAC Linker 36) can be used in the synthesis of the CP5V. CP5V is a PROTAC, and specifically degrades Cdc20[1].
Molecular Weight: 338, 353
