Product Overview
BMY-14802 hydrochloride | T22612 | TargetMol Chemicals
CAS: 105565-55-7
Smiles: Cl.O[C@H](CCCN1CCN(CC1)c1ncc(F)cn1)c1ccc(F)cc1
Formula: C18H23ClF2N4O
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: The theoretical role of sigma receptors in psychosis has led to the discovery of selective sigma receptor ligands as potential antipsychotic agents. BMY 14802 is a sigma receptor ligand (IC50: 112 nM for (+)-[3H]-3-PPP).
Molecular Weight: 384, 86
