Product Overview
BPK-29 hydrochloride | T13586L | TargetMol Chemicals
CAS: 2444815-73-8
Smiles: C1CC(CCN(C1)C(=O)C2=CC=C(C=C2)N3CCOCC3)N(CC4=CC=CC=C4)C(=O)CCl.Cl
Formula: C26H33Cl2N3O3
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: BPK-29 hydrochloride is a specific ligand that disrupts the atypical orphan nuclear receptor NR0B1-protein interactions by covalently modifying C274. It impairs the anchorage-independent growth of KEAP1-mutant cancer cells.
Molecular Weight: 506, 46
