Product Overview
BPK-29 | T13586 | TargetMol Chemicals
CAS: 2143467-62-1
Smiles: ClCC(=O)N(Cc1ccccc1)C1CCCN(CC1)C(=O)c1ccc(cc1)N1CCOCC1
Formula: C26H32ClN3O3
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: BPK-29 is a specific ligand that disrupts the atypical orphan nuclear receptor NR0B1-protein interactions by covalently modifying C274. It impairs the anchorage-independent growth of KEAP1-mutant cancer cells.
Molecular Weight: 470, 01
