Product Overview
BRD5459 | T30581 | TargetMol Chemicals
CAS: 612037-58-8
Smiles: COc1ccc(CCNc2c(CC=C)c(C)c(C#N)c3nc4ccccc4n23)cc1OC
Formula: C26H26N4O2
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: BRD5459 is a kind of reactive oxygen species enhancer that is non-toxic or leads to genotype selective cell death. Brd5459 can selectively kill cancer cells in various in vitro and in vivo models.
Molecular Weight: 426, 52