Bruceine D | TWS2045

Bruceine D | TWS2045 | TargetMol Chemicals

CAS: 21499-66-1

Smiles: CC1=CC(=O)[C@@H](O)[C@@]2(C)[C@H]1C[C@H]1OC(=O)[C@H](O)[C@@]3(O)[C@]4(C)OC[C@]13[C@@H]2[C@@H](O)[C@@H]4O

Formula: C20H26O9

Pathway: Apoptosis|||Immunology/Inflammation|||Microbiology/Virology|||Neuroscience|||Proteases/Proteasome|||Stem Cells

Target: Apoptosis|||Antiviral|||Gamma-secretase|||Parasite

Receptor: N/A

Bioactivity: 1. Bruceine D from Brucea javanica, may have the potential to be used as a natural viricide, or a lead compound for new viricides. 2. Bruceine D inhibits the growth of three pancreatic cancer cell lines, i.e., PANC-1, SW199 and CAPAN-1; induces cytotoxicity in Capan-2 cells via the induction of cellular apoptosis involving the mitochondrial pathway.

Molecular Weight: 410, 419