Product Overview
Calyxin B | TN3571 | TargetMol Chemicals
CAS: 164991-53-1
Smiles: COc1cc(O)c([C@@H](\C=C\C[C@@H](O)CCc2ccc(O)cc2)c2ccc(O)cc2)c(O)c1C(=O)\C=C\c1ccc(O)cc1
Formula: C35H34O8
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Calyxin B exhibits potent activity against human HT-1080 fibrosarcoma cells with an ED50 value of 0.69 microM. A methylated product of calyxin A and an epimeric mixture of Calyxin B, showed greatly reduced activity suggesting that phenolic hydroxyl groups are involved in the inhibitory activity.
Molecular Weight: 582, 7
