Product Overview
Campesterol | T4S2157 | TargetMol Chemicals
CAS: 474-62-4
Smiles: [H][C@@]12CC[C@H]([C@H](C)CC[C@@H](C)C(C)C)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@@H](O)CC[C@]12C
Formula: C28H48O
Pathway: Metabolism
Target: Endogenous Metabolite
Receptor: N/A
Bioactivity: Campesterol is a plant sterol with cholesterol lowering and anticarcinogenic effects, it and other plant sterols often decrease LDL cholesterol levels overall. Campesterol has anti-inflammatory effect, it inhibits several pro-inflammatory and matrix degradation mediators typically involved in osteoarthritis- induced cartilage degradation, also sometimes used to treat some specific prostate conditions.
Molecular Weight: 400, 7