Product Overview
Carboprost tromethamine | T14865 | TargetMol Chemicals
CAS: 58551-69-2
Smiles: NC(CO)(CO)CO.CCCCC[C@](C)(O)\C=C\[C@H]1[C@H](O)C[C@H](O)[C@@H]1C\C=C/CCCC(O)=O
Formula: C25H47NO8
Pathway: GPCR/G Protein|||Immunology/Inflammation
Target: Prostaglandin Receptor
Receptor: N/A
Bioactivity: Carboprost tromethamine is the synthetic 15-methyl analogue of prostaglandin F2α and it can effectively promote law contraction of the uterus and significantly reduce the amount of bleeding during and after delivery.
Molecular Weight: 489, 65
