Product Overview
β-Carotene | T1633 | TargetMol Chemicals
CAS: 7235-40-7
Smiles: C\C(\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C)=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C1=C(C)CCCC1(C)C
Formula: C40H56
Pathway: Apoptosis|||Immunology/Inflammation|||Metabolism
Target: Apoptosis|||ROS|||Endogenous Metabolite
Receptor: N/A
Bioactivity: Beta-Carotene is a naturally-occurring retinol (vitamin A) precursor obtained from certain fruits and vegetables with potential antineoplastic and chemopreventive activities. As an anti-oxidant, beta carotene inhibits free-radical damage to DNA.
Molecular Weight: 536, 888
