Product Overview
Casticin | T6S1373 | TargetMol Chemicals
CAS: 479-91-4
Smiles: COc1ccc(cc1O)-c1oc2cc(OC)c(OC)c(O)c2c(=O)c1OC
Formula: C19H18O8
Pathway: JAK/STAT signaling|||Stem Cells
Target: STAT
Receptor: N/A
Bioactivity: 1. Vitexicarpin can significantly reduce vascular inflammation, through inhibition of ROS-NF-κB pathway in vascular endothelial cells. 2. Vitexicarpin may become a potential leading drug in the therapy of prostate carcinoma.
Molecular Weight: 374, 345