Product Overview
Chelerythrine | T6S0052 | TargetMol Chemicals
CAS: 34316-15-9
Smiles: COc1ccc2c(c[n+](C)c3c4cc5OCOc5cc4ccc23)c1OC
Formula: C21H18NO4
Pathway: Apoptosis|||Autophagy|||Chromatin/Epigenetic|||Cytoskeletal Signaling
Target: Apoptosis|||BCL|||PKC|||Autophagy
Receptor: N/A
Bioactivity: 1. Chelerythrine may have antimanic effect . 2. Chelerythrine can inhibit telomerase activity. 3. Chelerythrine is a well-known protein kinase C inhibitor . 4. Chelerythrine has potential antiproliferative and antitumor effects.
Molecular Weight: 348, 377
