Product Overview
Chelidonine | T5S0055 | TargetMol Chemicals
CAS: 476-32-4
Smiles: CN1Cc2c3OCOc3ccc2[C@H]2[C@@H](O)Cc3cc4OCOc4cc3[C@@H]12
Formula: C20H19NO5
Pathway: Apoptosis|||Microbiology/Virology|||Others
Target: Apoptosis|||Others|||Influenza Virus
Receptor: N/A
Bioactivity: 1. Chelidonine isolated from Chelidonium majus efficiently induced apoptosis in HeLa cells through possible alteration of p38-p53 and AKT/PI3 kinase signalling pathways. 2. Chelidonine is a promising model compound for overcoming MDR and for enhancing cytotoxicity of chemotherapeutics, especially against leukaemia cells, its efficacy needs to be confirmed in animal models. 3. Chelidonine may be a potential therapeutic agent against metastasis of invasive human cancer cells, exhibits antimigratory and antiinvasive effects in MDA-MB-231 cells, by suppressing COL-induced integrin signaling, through inhibiting the formation of the IPP complex and subsequent downregulation of IPP downstream signaling molecules, such as Akt and ERK1/2.
Molecular Weight: 353, 374
