Product Overview
Chlorothalonil | T19914 | TargetMol Chemicals
CAS: 1897-45-6
Smiles: Clc1c(Cl)c(C#N)c(Cl)c(C#N)c1Cl
Formula: C8Cl4N2
Pathway: Microbiology/Virology
Target: Antifungal
Receptor: N/A
Bioactivity: Chlorothalonil is a broad-spectrum fungicide with high efficiency and low toxicity. Chlorothalonil is widely used to control various pests such as fruit trees and vegetable leaves. Chlorothalonil also has good control effects on various diseases such as rice, wheat, and cotton.
Molecular Weight: 265, 9