Product Overview
ChX710 | T13613 | TargetMol Chemicals
CAS: 2438721-44-7
Smiles: CC(CN(C)C)NC(=O)c1cccc2[nH]c(nc12)-c1ccncc1
Formula: C18H21N5O
Pathway: Immunology/Inflammation
Target: STING
Receptor: N/A
Bioactivity: ChX710 could prime the type I interferon response to cytosolic DNA, which specific cellular Interferon-Stimulated Genes (ISGs), induces the ISRE promoter sequence, and the phosphorylation of Interferon Regulatory Factor (IRF) 3.
Molecular Weight: 323, 4