Product Overview
CK-636 | T1820 | TargetMol Chemicals
CAS: 442632-72-6
Smiles: Cc1[nH]c2ccccc2c1CCNC(=O)c1cccs1
Formula: C16H16N2OS
Pathway: Cytoskeletal Signaling
Target: Microtubule Associated
Receptor: N/A
Bioactivity: CK-636, an Arp2/3 complex inhibitor, can inhibit actin polymerization induced by the human (IC50: 4 μM), fission yeast (IC50: 24 μM) and bovine (IC50: 32 μM) Arp2/3 complex, respectively.
Molecular Weight: 284, 38
