Product Overview
CKD-712 | T27033 | TargetMol Chemicals
CAS: 626252-75-3
Smiles: Oc1cc2CCN[C@@H](Cc3cccc4ccccc34)c2cc1O
Formula: C20H19NO2
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: CKD-712 is a nuclear factor NF-kappa B inhibitor. CKD-712 suppressed MMP-9, but not MMP-2 and other NF-κB-regulated proteins involved in cancer metastasis such as VEGF. CKD-712 induced cell cycle arrest at G2M phase by suppressing cyclin A, cyclin B and CDK-1 expression.
Molecular Weight: 305, 377
