Product Overview
Clomazone | T19781 | TargetMol Chemicals
CAS: 81777-89-1
Smiles: CC1(C)CON(Cc2ccccc2Cl)C1=O
Formula: C12H14ClNO2
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Clomazone is an agricultural herbicide. The molecule consists of a 2-chlorobenzyl group bound to an N-O heterocycle called Isoxazole. Clomazone suppresses the biosynthesis of chlorophyll and other plant pigments.
Molecular Weight: 239, 7