Product Overview
Coelenterazine h | T14994 | TargetMol Chemicals
CAS: 50909-86-9
Smiles: Oc1ccc(cc1)-c1cn2c(nc(Cc3ccccc3)c2=O)c(Cc2ccccc2)[nH]1
Formula: C26H21N3O2
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Coelenterazine H is a synthetic derivative of coelenterazine (a light-emitting biomolecule).Coelenterazine h is more sensitive to Ca 2+ than is the native complex, thus providing a valuable tool for measuring small changes in Ca 2+ concentrations.
Molecular Weight: 407, 473
