Product Overview
Cristacarpin | TN3719 | TargetMol Chemicals
CAS: 74515-47-2
Smiles: COc1ccc2c(O[C@H]3c4ccc(O)cc4OC[C@]23O)c1CC=C(C)C
Formula: C21H22O5
Pathway: Apoptosis|||Cell Cycle/Checkpoint|||Immunology/Inflammation|||MAPK|||Microbiology/Virology
Target: p38 MAPK|||ROS|||CDK|||Antifection|||p53
Receptor: N/A
Bioactivity: Cristacarpin exhibits moderate but selective activity towards DNA repair-deficient yeast mutants. It promotes endoplasmic reticulum (ER) stress, leading to sub-lethal reactive oxygen species (ROS) generation and which eventually terminates by triggering senescence in pancreatic and breast cancer cells through blocking the cell cycle in the G1 phase.
Molecular Weight: 354, 4