Product Overview
Cudraflavone B | TN3726 | TargetMol Chemicals
CAS: 19275-49-1
Smiles: CC(C)=CCc1c(oc2cc3OC(C)(C)C=Cc3c(O)c2c1=O)-c1ccc(O)cc1O
Formula: C25H24O6
Pathway: Autophagy|||Cytoskeletal Signaling|||Immunology/Inflammation|||Metabolism|||Neuroscience|||NF-Κb|||PI3K/Akt/mTOR signaling
Target: IκB/IKK|||MAO|||ROS|||Akt|||COX|||PI3K|||Nrf2|||Autophagy
Receptor: N/A
Bioactivity: Cudraflavone B has anti-proliferative activity, mouse brain monoamine oxidase (MAO) inhibitory effects, apoptotic actions in human gastric carcinoma cells and mouse melanoma cells, and hepatoprotective activity. It may be a lead for the development of a potential candidate for human oral squamous cell carcinoma cells.
Molecular Weight: 420, 45
