Cyclosporin B | T19848

(No reviews yet) Write a Review
€503.00 - €793.00
SKU:
TMC-T19848
Availability:
IN STOCK
Adding to cart… The item has been added

Cyclosporin B | T19848 | TargetMol Chemicals

CAS: 63775-95-1

Smiles: [H][C@@]1([C@H](O)[C@H](C)C\C=C\C)N(C)C(=O)[C@H](C(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](NC(=O)[C@H](CC(C)C)N(C)C(=O)CN(C)C(=O)[C@H](C)NC1=O)C(C)C

Formula: C61H109N11O12

Pathway: N/A

Target: N/A

Receptor: N/A

Bioactivity: Cyclosporin B is an immunosuppressant that has revolutionized organ transplantation through its use in the prevention of graft rejection. Cyclosporin B displays antiviral properties, inhibiting the entry of hepatitis B into hepatocytes. Cyclosporin B also inhibits RANKL-induced TRAP phosphatase activity, inducing apoptosis in osteoclasts. Cyclosporin B is a derivative of cyclosporin A that exhibits significantly less immunosuppressive activity.

Molecular Weight: 1188, 608