Product Overview
Cyclosporin B | T19848 | TargetMol Chemicals
CAS: 63775-95-1
Smiles: [H][C@@]1([C@H](O)[C@H](C)C\C=C\C)N(C)C(=O)[C@H](C(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](NC(=O)[C@H](CC(C)C)N(C)C(=O)CN(C)C(=O)[C@H](C)NC1=O)C(C)C
Formula: C61H109N11O12
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: Cyclosporin B is an immunosuppressant that has revolutionized organ transplantation through its use in the prevention of graft rejection. Cyclosporin B displays antiviral properties, inhibiting the entry of hepatitis B into hepatocytes. Cyclosporin B also inhibits RANKL-induced TRAP phosphatase activity, inducing apoptosis in osteoclasts. Cyclosporin B is a derivative of cyclosporin A that exhibits significantly less immunosuppressive activity.
Molecular Weight: 1188, 608
