Product Overview
Cytochalasin B | T7097 | TargetMol Chemicals
CAS: 14930-96-2
Smiles: C[C@H]1[C@H]2[C@H](Cc3ccccc3)NC(=O)[C@]22OC(=O)C=C[C@H](O)CCC[C@@H](C)C\C=C\[C@H]2[C@H](O)C1=C
Formula: C29H37NO5
Pathway: Cytoskeletal Signaling
Target: Arp2/3 Complex
Receptor: N/A
Bioactivity: Cytochalasin B is a mycotoxin binding to the barbed end of actin filaments. It can disrupt the formation of actin polymers (Kd: 1.4-2.2 nM for F-actin).
Molecular Weight: 479, 617
