Product Overview
Cytochalasin C | T13630 | TargetMol Chemicals
CAS: 22144-76-9
Smiles: [H][C@]12[C@H](Cc3ccccc3)NC(=O)[C@]11[C@H](OC(C)=O)\C=C\[C@@](C)(O)C(=O)[C@@H](C)C\C=C\[C@@]1([H])[C@H](O)C(C)=C2C
Formula: C30H37NO6
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Cytochalasin C is a cell-permeable fungal toxin that can induce the formation of nuclear sticks. Cytochalasin C is 10 times less toxic than cytochalasin D in mice.
Molecular Weight: 507, 627
