Cytochrome P450 CYP1B1 (190-198) [Homo sapiens] | TP2238

Cytochrome P450 CYP1B1 (190-198) [Homo sapiens] | TP2238 | TargetMol Chemicals

CAS: TP2238

Smiles: NC(C(NC(CC(C)C)C(NC(CC(O)=O)C(N1C(C(NC(CCCNC(N)=N)C(N2CCCC2C(NC(CC(C)C)C(NC(C(C)O)C(NC(C(C)C)C(O)=O)=O)=O)=O)=O)=O)CCC1)=O)=O)=O)CC3=CC=CC=C3

Formula: C50H80N12O13

Pathway: Others

Target: Others

Receptor: N/A

Bioactivity: Cytochrome c is a small heme protein found loosely associated with the inner membrane of the mitochondrion. Cytochromes c from certain eukaryotes, including plants and fungi but not higher animals, contains methylated lysine residues at specific positions1. Cytochrome c is a required cofactor for Apaf-1 function2.

Molecular Weight: 1057, 24