Product Overview
D-Glucaric acid potassium | T4916 | TargetMol Chemicals
CAS: 576-42-1
Smiles: [K+].OC(C(O)C(O)C([O-])=O)C(O)C(O)=O
Formula: C6H9KO8
Pathway: Metabolism|||Others
Target: Others|||Endogenous Metabolite
Receptor: N/A
Bioactivity: D-Saccharic acid potassium salt is a compound formed from oxidizing sugars, which can be used to test for the presence of hepatic enzyme induction. Studies indicate that D-glucuronolactone dehydrogenase oxidizes D-Saccharic acid potassium salt into D-glucaro-l, 4;6, 3-dilactone. Alternate studies suggest that D-Saccharic acid potassium salt forms a complex with Cu(II) and H2O2to decolorize azo, acridine, triphenyl methane, anthraquinone and thiazine-based dyes.
Molecular Weight: 248, 228
