Product Overview
D-Methionine sulfoxide hydrochloride | T19264 | TargetMol Chemicals
CAS: T19264
Smiles: N[C@H](CCS(C)=O)C(O)=O.[H]Cl
Formula: C5H12ClNO3S
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: D-methionine sulfoxide hydrochloride is the D-isomer of methionine sulfoxide hydrochloride. Methionine sulfoxide is the oxidation product of methionine. Methionine is a restrictive amino acid in milk or legume proteins and is easily oxidized during storage or processing.
Molecular Weight: 201, 67
