Product Overview
D-(+)-Trehalose | T2O2798 | TargetMol Chemicals
CAS: 99-20-7
Smiles: OC[C@H]1O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O
Formula: C12H22O11
Pathway: Metabolism|||Others
Target: Others|||Endogenous Metabolite
Receptor: N/A
Bioactivity: D-Trehalose can inhibit the decomposition of collagen, so it can be used to improve osteoporosis.
Molecular Weight: 342, 297
![[D-Arg1, D-Phe5, D-Trp7, 9, Leu11]-Substance P](https://cdn11.bigcommerce.com/s-2kvb5rm600/images/stencil/500x659/products/55083/51739/TargetMol-768x384__12443.1665998863__68435.1666081067.png?c=1 "[D-Arg1, D-Phe5, D-Trp7, 9, Leu11]-Substance P")
![[D-Arg1, D-Phe5, D-Trp7, 9, Leu11]-Substance P acetate](https://cdn11.bigcommerce.com/s-2kvb5rm600/images/stencil/500x659/products/55084/51740/TargetMol-768x384__12443.1665998863__89409.1666081068.png?c=1 "[D-Arg1, D-Phe5, D-Trp7, 9, Leu11]-Substance P acetate")