Product Overview
Dalbergin | TJS0856 | TargetMol Chemicals
CAS: 482-83-7
Smiles: COc1cc2oc(=O)cc(-c3ccccc3)c2cc1O
Formula: C16H12O4
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 1. Dalbergin exhibits similar bone conserving effect against bone-loss as estradiol treatment, it as a therapeutic candidate against postmenopausal osteoporosis. 2. Dalbergin prevents some effects of photoaging and maintain skin integrity by regulating the degradation of the extracellular matrix proteins.
Molecular Weight: 268, 268
