Product Overview
Danshenxinkun A | TN1550 | TargetMol Chemicals
CAS: 65907-75-7
Smiles: CC(CO)C1=C(O)C(=O)c2c(ccc3c(C)cccc23)C1=O
Formula: C18H16O4
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Danshenxinkun A, Danshenxinkun B and Neocryptotanshinone may intervene thrombotic diseases by adjusting the targets mainly involved in pathways of endocrine system, signal transduction, signaling molecules and interaction, cell motility, environmental adaptation and nervous system.
Molecular Weight: 296, 322
