Product Overview
Dansyl chloride | T18967 | TargetMol Chemicals
CAS: 605-65-2
Smiles: CN(C)c1cccc2c(cccc12)S(Cl)(=O)=O
Formula: C12H12ClNO2S
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Dansyl chloride reacts with primary amino groups in both aliphatic and aromatic amines to produce stable blue- or blue-green-fluorescent sulfonamide adducts. It is widely used to modify amino acids, specifically, protein sequencing and amino acid analysis.
Molecular Weight: 269, 74
