Product Overview
Darutoside | T3S1944 | TargetMol Chemicals
CAS: 59219-65-7
Smiles: CC1(C)[C@@H](CC[C@@]2(C)[C@@H]3CC[C@@](C)(C=C3CC[C@H]12)[C@@H](O)CO)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
Formula: C26H44O8
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 1. Darutoside can as an appropriate treatment for wounds. 2. Darutoside can improve skin elasticity, surface appearance and stretch mark removal, through soothing the skin, decreasing inflammation, restoring collagen and promoting collagen production.
Molecular Weight: 484, 63
