Product Overview
Dehydroabietic acid | TCS1772 | TargetMol Chemicals
CAS: 1740-19-8
Smiles: CC(C)c1ccc2c(CC[C@H]3[C@@](C)(CCC[C@]23C)C(O)=O)c1
Formula: C20H28O2
Pathway: Microbiology/Virology
Target: Antifection
Receptor: N/A
Bioactivity: 1. Dehydroabietic acid (DAA) is an EBV-EA activation inhibitor. 2. DAA is a useful food-derived compound for treating obesity-related diseases, by decreasing plasma glucose, insulin levels, plasma triglyceride (TG), and hepatic TG levels. 3. DAA derivatives displays anti-secretory and anti-pepsin effect in animal models.
Molecular Weight: 300, 442
