Product Overview
Dehydroevodiamine | T2S2335 | TargetMol Chemicals
CAS: 67909-49-3
Smiles: C[n+]1c2-c3[nH]c4ccccc4c3CCn2c(=O)c2ccccc12
Formula: C19H16N3O
Pathway: Immunology/Inflammation|||Neuroscience|||NF-Κb|||Others
Target: Others|||NF-κB|||COX|||PGE Synthase|||NO Synthase
Receptor: N/A
Bioactivity: Dehydroevodiamine, a constituent of Evodia rutaecarpa, has various biological effects such as hypotensive, negative chronotropic, ion channel depressant, inhibition of nitric oxide production and cerebral blood flow enhancing activities.
Molecular Weight: 302, 356
