Product Overview
Demeclocycline hydrochloride | T1400 | TargetMol Chemicals
CAS: 64-73-3
Smiles: Cl.[H][C@]12C[C@@]3([H])[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)ccc(Cl)c1[C@H]2O
Formula: C21H22Cl2N2O8
Pathway: Microbiology/Virology
Target: ribosome|||Antibacterial|||Antibiotic
Receptor: N/A
Bioactivity: Demeclocycline hydrochloride is a TETRACYCLINE analog having a 7-chloro and a 6-methyl. Because it is excreted more slowly than TETRACYCLINE, it maintains effective blood levels for longer periods of time.
Molecular Weight: 501, 31
