Product Overview
Demethoxydeacetoxypseudolaric acid B analog | T13643 | TargetMol Chemicals
CAS: 500736-17-4
Smiles: O=C(C(CC[C@]1(O)[C@]2([H])[C@@](C)(/C=C/C=C(C(O)=O)\C)O3)=CC[C@@]1(CC2)C3=O)O
Formula: C24H30O8
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Demethoxydeacetoxypseudolaric acid B analog has potent activities against HMEC-1, HL-60, A-549, MB-MDA-468, BEL-7402, HCT116, and Hela cells with IC50s ranging from 0.136 to 1.162 μM. and is semi-synthesized by efficient routines from Pseudolaric acid B.
Molecular Weight: 446, 49
