Product Overview
Dendrobine | T5S1708 | TargetMol Chemicals
CAS: 2115-91-5
Smiles: CC(C)[C@@H]1[C@H]2OC(=O)[C@@H]1[C@@H]1CC[C@@H]3CN(C)[C@H]2[C@]13C
Formula: C16H25NO2
Pathway: Microbiology/Virology|||Others
Target: Others|||Influenza Virus
Receptor: N/A
Bioactivity: 1. Dendrobine has a slight but demonstrable analgesic and antipyretic action. 2. Dendrobine produces moderate hyperglycemia, diminishes cardiac activity in large doses, lowers the blood pressure. 3. Dendrobine on the electrical activity and on amino acid-induced depolarizations of primary afferent terminals were tested on the frog isolated spinal cord.
Molecular Weight: 263, 381
