Product Overview
Desmethoxyyangonin | T5S0734 | TargetMol Chemicals
CAS: 15345-89-8
Smiles: COc1cc(\C=C\c2ccccc2)oc(=O)c1
Formula: C14H12O3
Pathway: Neuroscience|||Others
Target: Others|||Monoamine Oxidase
Receptor: N/A
Bioactivity: 1. Desmethoxy yangonin protects LPS or LPS/D-GalN-induced damages in cell or liver tissues mainly through de-regulating IKK/NFκB and Jak2/STAT3 signaling pathways. 2. The induction of CYP3A23 by dihydromethysticin and Desmethoxy yangonin involves transcription activation, probably through a PXR-independent or PXR-involved indirect mechanism.
Molecular Weight: 228, 247