Product Overview
Dihydrochelerythrine | T3S0057 | TargetMol Chemicals
CAS: 6880-91-7
Smiles: COc1ccc-2c(CN(C)c3c-2ccc2cc4OCOc4cc32)c1OC
Formula: C21H19NO4
Pathway: Microbiology/Virology
Target: Antifungal
Receptor: N/A
Bioactivity: 1. Dihydrochelerythrine is nontoxic up to 5μM concentration. 2. Dihydrochelerythrine has antifungal activity against pathogenic plant fungi. 3. Dihydrochelerythrine has potential application in the therapy of serious infection caused by I. multifiliis. 4. Dihydrochelerythrine affects cell cycle distribution, activates mitochondrial apoptotic pathway, and induces apoptosis and necrosis in HL-6 cells.
Molecular Weight: 349, 386