Product Overview
Dihydrocucurbitacin B | TN1579 | TargetMol Chemicals
CAS: 13201-14-4
Smiles: [H][C@@]12C[C@H](O)C(=O)C(C)(C)C1=CC[C@@]1([H])[C@]3(C)C[C@@H](O)[C@H]([C@@](C)(O)C(=O)CCC(C)(C)OC(C)=O)[C@@]3(C)CC(=O)[C@@]21C
Formula: C32H48O8
Pathway: Apoptosis|||Immunology/Inflammation|||Neuroscience
Target: IL Receptor|||TNF|||COX
Receptor: N/A
Bioactivity: Dihydrocucurbitacin B has anti-cancer activity, it reduces cell proliferation due to a decrease in the expression of cyclins, mainly cyclin-B1 and disruption of the actin cytoskeleton, arresting B16F10 cells in G2/M phase.
Molecular Weight: 560, 728
