Product Overview
Dihydrolycorine | T3S1729 | TargetMol Chemicals
CAS: 6271-21-2
Smiles: O[C@H]1C[C@H]2CCN3Cc4cc5OCOc5cc4[C@@H]([C@@H]23)[C@@H]1O
Formula: C16H19NO4
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: 1. Dihydrolycorine-HCL(DL) shows hypotensive effects, it can block alpha 1-adrenoceptors. 2. Dihydrolycorine is an inhibitors of protein synthesis in eukarytic cells, it halts protein synthesis in eukaryotic cells by inhibiting the peptide bone formation step. 3. Dihydrolycorine and nimodipine protects against anoxia damage of brain in rat.
Molecular Weight: 289, 33