Product Overview
Dinotefuran | T7124 | TargetMol Chemicals
CAS: 165252-70-0
Smiles: CN\C(NCC1CCOC1)=N\[N+]([O-])=O
Formula: C7H14N4O3
Pathway: Microbiology/Virology|||Neuroscience|||Others
Target: Others|||AChR|||Parasite
Receptor: N/A
Bioactivity: Dinotefuran is an insecticide of the neonicotinoid class for control of insect pests such as aphids, whiteflies, thrips, leafhoppers, leafminers. Its mechanism of action involves disruption of the insect's nervous system by inhibiting nicotinic acetylcholine receptors.
Molecular Weight: 202, 214
