Product Overview
Diptoindonesin G | T31523 | TargetMol Chemicals
CAS: 1190948-58-3
Smiles: Oc1ccc(cc1)-c1oc2cc(O)cc3C(=O)c4c(O)cc(O)cc4-c1c23
Formula: C21H12O6
Pathway: N/A
Target: N/A
Receptor: N/A
Bioactivity: Diptoindonesin G is an ERß stabilizer that regulates the stability of ERα and ERß by targeting CHIP E3 ubiquitin ligase. Diptoindonesin G could significantly increase the protein stability of ERß, and reduce the protein level of ERα,
Molecular Weight: 360, 321
