Product Overview
Dithianon | T19285 | TargetMol Chemicals
CAS: 3347-22-6
Smiles: O=c1c2ccccc2c(=O)c2sc(C#N)c(sc12)C#N
Formula: C14H4N2O2S2
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Dithianon is a broad-spectrum anthraquinone fungicide with good adhesion to the surface of leaves and fruits. Dithianon can be used to control several fungi in certain fruits and vegetables.
Molecular Weight: 296, 32