Product Overview
Engeletin | T6S0840 | TargetMol Chemicals
CAS: 572-31-6
Smiles: C[C@@H]1O[C@@H](O[C@@H]2[C@H](Oc3cc(O)cc(O)c3C2=O)c2ccc(O)cc2)[C@H](O)[C@H](O)[C@H]1O
Formula: C21H22O10
Pathway: Endocrinology/Hormones|||Metabolism|||NF-Κb
Target: NF-κB|||Reductase
Receptor: N/A
Bioactivity: 1. Engeletin may serve as a potential anti-inflammatory agent. 2. Engeletin possesses potent inhibition of PGE2 release with IC5 values of 19.6 μg/ml. 3. Engeletin inhibits a recombinant human aldose reductase (IC5 value=1.16 microM).
Molecular Weight: 434, 397
