Product Overview
Ensulizole | T19310 | TargetMol Chemicals
CAS: 27503-81-7
Smiles: OS(=O)(=O)c1ccc2nc([nH]c2c1)-c1ccccc1
Formula: C13H10N2O3S
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Ensulizole can damage the DNA through the generation of reactive oxygen species (ROS) upon UV or sunlight irradiation. Ensulizole is a water soluble sunscreen ingredient.Ensulizole is a sulfonated UV absorber and can intense UVB and partial UVA absorption.
Molecular Weight: 274, 29