Product Overview
Epifriedelanol | T3768 | TargetMol Chemicals
CAS: 16844-71-6
Smiles: C[C@H]1[C@@H](O)CC[C@H]2[C@]1(C)CC[C@@]1(C)[C@@]2(C)CC[C@@]2(C)[C@@H]3CC(C)(C)CC[C@]3(C)CC[C@]12C
Formula: C31H54O
Pathway: Others
Target: Others
Receptor: N/A
Bioactivity: Epifriedelanol suppresses adriamycin-induced cellular senescence, replicative senescence in human fibroblasts (HDFs) and HUVECs. Because of Epifriedelanol can reduce cellular senescence in human primary cells, it may be used to develop dietary supplements or cosmetics that modulate tissue aging or aging-associated diseases.
Molecular Weight: 442, 772
